Products 913835-85-5

CAS 913835-85-5 is the registry number for 4-(3-Methoxypropylcarbamoyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

[4-(3-methoxypropylcarbamoyl)phenyl]boronic acid (CAS 913835-85-5) is a chemical compound with the molecular formula C11H16BNO4 and a molecular weight of 237.06 g/mol. IUPAC name: [4-(3-methoxypropylcarbamoyl)phenyl]boronic acid. InChIKey: XYVBRVOOLKNOIC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16BNO4
Molecular weight237.06 g/mol
IUPAC name[4-(3-methoxypropylcarbamoyl)phenyl]boronic acid
InChIKeyXYVBRVOOLKNOIC-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C(=O)NCCCOC)(O)O

Computed by PubChem (NCBI)