cas: 380430-49-9 — see every product listed under this CAS number, including other names
(4-Boc-aminophenyl)boronic acid, 99.95% (CAS 380430-49-9) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W000923-10 g |
| cas | 380430-49-9 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 310.40 Pln | |
| MedChemExpress | 5 g | 240.74 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.95% |
[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 380430-49-9) is a chemical compound with the molecular formula C11H16BNO4 and a molecular weight of 237.06 g/mol. IUPAC name: [4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: UBVOLHQIEQVXGM-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO4 |
|---|---|
| Molecular weight | 237.06 g/mol |
| IUPAC name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | UBVOLHQIEQVXGM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)