CAS 380430-68-2 appears in our catalog under these names: 3-[(tert-Butoxycarbonyl)amino]phenylboronic Acid (contains varying amounts of Anhydride), 3-(N-Boc-amino)phenylboronic acid 97%, 3-(N-BOC-AMINO)PHENYLBORONIC ACID, >=95%, (3-Boc-Aminophenyl)boronic acid, 97%, 97%, 3-(N-Boc-amino)phenylboronic acid, 99.96%. Offered by: TCI, Ambeed, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g, 5 g, 10 g.
[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 380430-68-2) is a chemical compound with the molecular formula C11H16BNO4 and a molecular weight of 237.06 g/mol. IUPAC name: [3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: CWLNHPXWZRALFS-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO4 |
|---|---|
| Molecular weight | 237.06 g/mol |
| IUPAC name | [3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | CWLNHPXWZRALFS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)