CAS 2377609-32-8 appears in our catalog under these names: 4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-2-carboxylic acid, 95%, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-2-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-2-carboxylic acid (CAS 2377609-32-8) is a chemical compound with the molecular formula C11H16BNO4 and a molecular weight of 237.06 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-2-carboxylic acid. InChIKey: UXMWWDUQALHNMP-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO4 |
|---|---|
| Molecular weight | 237.06 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | UXMWWDUQALHNMP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CNC(=C2)C(=O)O |
Computed by PubChem (NCBI)