cas: 130870-00-7 — see every product listed under this CAS number, including other names
(4-Bromo-2,5-dimethylphenyl)boronic acid 98% (CAS 130870-00-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A122305-250mg |
| cas | 130870-00-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 25g | 2050.25 Pln | |
| Ambeed | 100g | 7963.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A122305 |
(4-bromo-2,5-dimethylphenyl)boronic acid (CAS 130870-00-7) is a chemical compound with the molecular formula C8H10BBrO2 and a molecular weight of 228.88 g/mol. IUPAC name: (4-bromo-2,5-dimethylphenyl)boronic acid. InChIKey: FUVZURQKCDUKIR-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO2 |
|---|---|
| Molecular weight | 228.88 g/mol |
| IUPAC name | (4-bromo-2,5-dimethylphenyl)boronic acid |
| InChIKey | FUVZURQKCDUKIR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)Br)C)(O)O |
Computed by PubChem (NCBI)