CAS 1451391-29-9 appears in our catalog under these names: (4-bromo-2,3-dimethylphenyl)boronic acid, 95%, (4-Bromo-2,3-dimethylphenyl)boronic acid, 98+%, 4-Bromo-2,3-dimethylphenylboronic acid, 98+%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
(4-bromo-2,3-dimethylphenyl)boronic acid (CAS 1451391-29-9) is a chemical compound with the molecular formula C8H10BBrO2 and a molecular weight of 228.88 g/mol. IUPAC name: (4-bromo-2,3-dimethylphenyl)boronic acid. InChIKey: WKRSZLGVZKKFTJ-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO2 |
|---|---|
| Molecular weight | 228.88 g/mol |
| IUPAC name | (4-bromo-2,3-dimethylphenyl)boronic acid |
| InChIKey | WKRSZLGVZKKFTJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Br)C)C)(O)O |
Computed by PubChem (NCBI)