CAS 1160561-24-9 appears in our catalog under these names: 4-Bromo-2,6-dimethylphenylboronic acid, 95%, (4-Bromo-2,6-dimethylphenyl)boronic acid 95%, (4-Bromo-2,6-dimethylphenyl)boronic acid, 95%, 95%, 4-Bromo-2,6-dimethylphenylboronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg.
(4-bromo-2,6-dimethylphenyl)boronic acid (CAS 1160561-24-9) is a chemical compound with the molecular formula C8H10BBrO2 and a molecular weight of 228.88 g/mol. IUPAC name: (4-bromo-2,6-dimethylphenyl)boronic acid. InChIKey: OGYKUMRPICACAC-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO2 |
|---|---|
| Molecular weight | 228.88 g/mol |
| IUPAC name | (4-bromo-2,6-dimethylphenyl)boronic acid |
| InChIKey | OGYKUMRPICACAC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)Br)C)(O)O |
Computed by PubChem (NCBI)