CAS 854662-84-3 appears in our catalog under these names: (5-Bromo-2,4-dimethylphenyl)boronic acid, 95%, (5-Bromo-2,4-dimethylphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(5-bromo-2,4-dimethylphenyl)boronic acid (CAS 854662-84-3) is a chemical compound with the molecular formula C8H10BBrO2 and a molecular weight of 228.88 g/mol. IUPAC name: (5-bromo-2,4-dimethylphenyl)boronic acid. InChIKey: YOMQBBPILMACMT-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO2 |
|---|---|
| Molecular weight | 228.88 g/mol |
| IUPAC name | (5-bromo-2,4-dimethylphenyl)boronic acid |
| InChIKey | YOMQBBPILMACMT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)C)Br)(O)O |
Computed by PubChem (NCBI)