cas: 130870-00-7 — see every product listed under this CAS number, including other names
(4-Bromo-2,5-dimethylphenyl)boronic acid, 98%, 98% (CAS 130870-00-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111V2Q-250mg |
| cas | 130870-00-7 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 525.20 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 10g | 986.00 Pln | |
| Chemat | 25g | 1941.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-bromo-2,5-dimethylphenyl)boronic acid (CAS 130870-00-7) is a chemical compound with the molecular formula C8H10BBrO2 and a molecular weight of 228.88 g/mol. IUPAC name: (4-bromo-2,5-dimethylphenyl)boronic acid. InChIKey: FUVZURQKCDUKIR-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO2 |
|---|---|
| Molecular weight | 228.88 g/mol |
| IUPAC name | (4-bromo-2,5-dimethylphenyl)boronic acid |
| InChIKey | FUVZURQKCDUKIR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)Br)C)(O)O |
Computed by PubChem (NCBI)