(4-Bromo-2,6-difluorophenyl)methanamine hydrochloride, 97%
cas: 1461655-72-0 — see every product listed under this CAS number, including other names
(4-Bromo-2,6-difluorophenyl)methanamine hydrochloride, 97% (CAS 1461655-72-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A446572-100mg |
| cas | 1461655-72-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 426.00 Pln | |
| Ambeed | 5g | 1293.75 Pln | |
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 760.40 Pln | |
| BLDpharm | 100mg | 203.29 Pln | |
| BLDpharm | 250mg | 258.82 Pln | |
| BLDpharm | 1g | 453.20 Pln | |
| BLDpharm | 5g | 1386.20 Pln | |
| Fluorochem | 250mg | 430.07 Pln | |
| Fluorochem | 1g | 1414.10 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4-bromo-2,6-difluorophenyl)methanamine;hydrochloride (CAS 1461655-72-0) is a chemical compound with the molecular formula C7H7BrClF2N and a molecular weight of 258.49 g/mol. IUPAC name: (4-bromo-2,6-difluorophenyl)methanamine;hydrochloride. InChIKey: WVXBSPZRXCEBDW-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClF2N |
|---|---|
| Molecular weight | 258.49 g/mol |
| IUPAC name | (4-bromo-2,6-difluorophenyl)methanamine;hydrochloride |
| InChIKey | WVXBSPZRXCEBDW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)CN)F)Br.Cl |
Computed by PubChem (NCBI)
Synonyms:
(4-Bromo-2,6-difluorophenyl)methanamine hydrochloride, 4-Bromo-2,6-difluorobenzylamine hydrochloride, (4-bromo-2,6-difluorophenyl)methanamine;hydrochloride, (4-Bromo-2,6-difluorophenyl)methanamine HCl, (4-Bromo-2,6-difluorophenyl)methanaminehydrochloride, (4-bromo-2,6-difluoro-phenyl)methanamine;hydrochloride