CAS 2231675-44-6 appears in our catalog under these names: (2-Bromo-3,4-difluorophenyl)methanamine hydrochloride, (2-Bromo-3,4-difluorophenyl)methanamine hydrochloride 98%, (2-Bromo-3,4-difluorophenyl)methanamine hydrochloride, 98%, 98%, 1-(2-BROMO-3,4-DIFLUOROPHENYL)METHANAMINE HYDROCHLORIDE, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g, 10g.
(2-bromo-3,4-difluorophenyl)methanamine;hydrochloride (CAS 2231675-44-6) is a chemical compound with the molecular formula C7H7BrClF2N and a molecular weight of 258.49 g/mol. IUPAC name: (2-bromo-3,4-difluorophenyl)methanamine;hydrochloride. InChIKey: ZMDQCABNAOYNNJ-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClF2N |
|---|---|
| Molecular weight | 258.49 g/mol |
| IUPAC name | (2-bromo-3,4-difluorophenyl)methanamine;hydrochloride |
| InChIKey | ZMDQCABNAOYNNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CN)Br)F)F.Cl |
Computed by PubChem (NCBI)