(4-Bromo-2-fluoro-5-methylphenyl)boronic acid 97%
cas: 677777-57-0 — see every product listed under this CAS number, including other names
(4-Bromo-2-fluoro-5-methylphenyl)boronic acid 97% (CAS 677777-57-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A192166-100mg |
| cas | 677777-57-0 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 909.94 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A192166 |
(4-bromo-2-fluoro-5-methylphenyl)boronic acid (CAS 677777-57-0) is a chemical compound with the molecular formula C7H7BBrFO2 and a molecular weight of 232.84 g/mol. IUPAC name: (4-bromo-2-fluoro-5-methylphenyl)boronic acid. InChIKey: IZFBYUHHOMKXAR-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrFO2 |
|---|---|
| Molecular weight | 232.84 g/mol |
| IUPAC name | (4-bromo-2-fluoro-5-methylphenyl)boronic acid |
| InChIKey | IZFBYUHHOMKXAR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)Br)C)(O)O |
Computed by PubChem (NCBI)