Products 2246650-88-2
CAS 2246650-88-2 appears in our catalog under these names: 3-Bromo-2-fluoro-6-methylphenylboronic acid, 3-Bromo-2-fluoro-6-methylphenylboronic acid, 96%. Offered by: Biosynth, Combi-blocks, Ambeed, Chemat, BLDpharm. Available pack sizes: 2,5g, 5g, 10g, 1g, 250mg.
(3-bromo-2-fluoro-6-methylphenyl)boronic acid (CAS 2246650-88-2) is a chemical compound with the molecular formula C7H7BBrFO2 and a molecular weight of 232.84 g/mol. IUPAC name: (3-bromo-2-fluoro-6-methylphenyl)boronic acid. InChIKey: FXPYHAXAVPHRAH-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrFO2 |
|---|---|
| Molecular weight | 232.84 g/mol |
| IUPAC name | (3-bromo-2-fluoro-6-methylphenyl)boronic acid |
| InChIKey | FXPYHAXAVPHRAH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)Br)C)(O)O |
Computed by PubChem (NCBI)