CAS 2663787-30-0 is the registry number for 3-(Bromomethyl)-2-fluorobenzeneboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[3-(bromomethyl)-2-fluorophenyl]boronic acid (CAS 2663787-30-0) is a chemical compound with the molecular formula C7H7BBrFO2 and a molecular weight of 232.84 g/mol. IUPAC name: [3-(bromomethyl)-2-fluorophenyl]boronic acid. InChIKey: GVZLMMGAKCIJAG-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrFO2 |
|---|---|
| Molecular weight | 232.84 g/mol |
| IUPAC name | [3-(bromomethyl)-2-fluorophenyl]boronic acid |
| InChIKey | GVZLMMGAKCIJAG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)CBr)F)(O)O |
Computed by PubChem (NCBI)