CAS 1315340-53-4 appears in our catalog under these names: 2-Bromo-3-fluoro-6-methylphenylboronic acid, 95%, 2-Bromo-3-fluoro-6-methylphenylboronic acid, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, on request.
(2-bromo-3-fluoro-6-methylphenyl)boronic acid (CAS 1315340-53-4) is a chemical compound with the molecular formula C7H7BBrFO2 and a molecular weight of 232.84 g/mol. IUPAC name: (2-bromo-3-fluoro-6-methylphenyl)boronic acid. InChIKey: QPOFDXHLEXUJHQ-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrFO2 |
|---|---|
| Molecular weight | 232.84 g/mol |
| IUPAC name | (2-bromo-3-fluoro-6-methylphenyl)boronic acid |
| InChIKey | QPOFDXHLEXUJHQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Br)F)C)(O)O |
Computed by PubChem (NCBI)