Products 677777-57-0
CAS 677777-57-0 appears in our catalog under these names: 4-Bromo-2-fluoro-5-methylphenylboronic acid, 97%, (4-Bromo-2-fluoro-5-methylphenyl)boronic acid 97%, 4-Bromo-2-fluoro-5-methylphenylboronic acid, 97%, 97%, (4-Bromo-2-fluoro-5-methylphenyl)boronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
(4-bromo-2-fluoro-5-methylphenyl)boronic acid (CAS 677777-57-0) is a chemical compound with the molecular formula C7H7BBrFO2 and a molecular weight of 232.84 g/mol. IUPAC name: (4-bromo-2-fluoro-5-methylphenyl)boronic acid. InChIKey: IZFBYUHHOMKXAR-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrFO2 |
|---|---|
| Molecular weight | 232.84 g/mol |
| IUPAC name | (4-bromo-2-fluoro-5-methylphenyl)boronic acid |
| InChIKey | IZFBYUHHOMKXAR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)Br)C)(O)O |
Computed by PubChem (NCBI)