cas: 2096339-74-9 — see every product listed under this CAS number, including other names
(4-Butoxy-2,3-dichlorophenyl)boronic acid 97% (CAS 2096339-74-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A127500-250mg |
| cas | 2096339-74-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 854.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A127500 |
(4-butoxy-2,3-dichlorophenyl)boronic acid (CAS 2096339-74-9) is a chemical compound with the molecular formula C10H13BCl2O3 and a molecular weight of 262.92 g/mol. IUPAC name: (4-butoxy-2,3-dichlorophenyl)boronic acid. InChIKey: JXEAGLCIPVWOBY-UHFFFAOYSA-N.
| Molecular formula | C10H13BCl2O3 |
|---|---|
| Molecular weight | 262.92 g/mol |
| IUPAC name | (4-butoxy-2,3-dichlorophenyl)boronic acid |
| InChIKey | JXEAGLCIPVWOBY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCCCC)Cl)Cl)(O)O |
Computed by PubChem (NCBI)