CAS 1218790-72-7 appears in our catalog under these names: 4-Butoxy-3,5-dichlorophenylboronic acid, 98%, (4-Butoxy-3,5-dichlorophenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 100g, 1g, 250mg.
(4-butoxy-3,5-dichlorophenyl)boronic acid (CAS 1218790-72-7) is a chemical compound with the molecular formula C10H13BCl2O3 and a molecular weight of 262.92 g/mol. IUPAC name: (4-butoxy-3,5-dichlorophenyl)boronic acid. InChIKey: CZGPPYHWISSCGP-UHFFFAOYSA-N.
| Molecular formula | C10H13BCl2O3 |
|---|---|
| Molecular weight | 262.92 g/mol |
| IUPAC name | (4-butoxy-3,5-dichlorophenyl)boronic acid |
| InChIKey | CZGPPYHWISSCGP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OCCCC)Cl)(O)O |
Computed by PubChem (NCBI)