CAS 1256346-46-9 is the registry number for 2,4-Dichloro-5-isobutoxyphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[2,4-dichloro-5-(2-methylpropoxy)phenyl]boronic acid (CAS 1256346-46-9) is a chemical compound with the molecular formula C10H13BCl2O3 and a molecular weight of 262.92 g/mol. IUPAC name: [2,4-dichloro-5-(2-methylpropoxy)phenyl]boronic acid. InChIKey: NIDCPTZXOXJCGW-UHFFFAOYSA-N.
| Molecular formula | C10H13BCl2O3 |
|---|---|
| Molecular weight | 262.92 g/mol |
| IUPAC name | [2,4-dichloro-5-(2-methylpropoxy)phenyl]boronic acid |
| InChIKey | NIDCPTZXOXJCGW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)Cl)OCC(C)C)(O)O |
Computed by PubChem (NCBI)