Products 2096329-79-0

CAS 2096329-79-0 appears in our catalog under these names: 2,3-Dichloro-4-isobutoxyphenylboronic acid, 98%, (2,3-Dichloro-4-isobutoxyphenyl)boronic acid 97%, 2,3-DICHLORO-4-ISOBUTOXYPHENYLBORONIC ACID, 97%, 97%, 2,3-Dichloro-4-isobutoxyphenylboronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

[2,3-dichloro-4-(2-methylpropoxy)phenyl]boronic acid (CAS 2096329-79-0) is a chemical compound with the molecular formula C10H13BCl2O3 and a molecular weight of 262.92 g/mol. IUPAC name: [2,3-dichloro-4-(2-methylpropoxy)phenyl]boronic acid. InChIKey: DPYMREBBALMFOP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13BCl2O3
Molecular weight262.92 g/mol
IUPAC name[2,3-dichloro-4-(2-methylpropoxy)phenyl]boronic acid
InChIKeyDPYMREBBALMFOP-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)OCC(C)C)Cl)Cl)(O)O

Computed by PubChem (NCBI)