CAS 1256354-88-7 is the registry number for 5-Butoxy-2,4-dichlorophenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(5-butoxy-2,4-dichlorophenyl)boronic acid (CAS 1256354-88-7) is a chemical compound with the molecular formula C10H13BCl2O3 and a molecular weight of 262.92 g/mol. IUPAC name: (5-butoxy-2,4-dichlorophenyl)boronic acid. InChIKey: UNUSRHVSANUKKR-UHFFFAOYSA-N.
| Molecular formula | C10H13BCl2O3 |
|---|---|
| Molecular weight | 262.92 g/mol |
| IUPAC name | (5-butoxy-2,4-dichlorophenyl)boronic acid |
| InChIKey | UNUSRHVSANUKKR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)Cl)OCCCC)(O)O |
Computed by PubChem (NCBI)