cas: 1215723-25-3 — see every product listed under this CAS number, including other names
(4-CHLOROPHENYL)(PIPERIDIN-3-YL)METHANONE HCL (CAS 1215723-25-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110GWE-100mg |
| cas | 1215723-25-3 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 549.20 Pln | |
| Chemat | 1g | 1672.40 Pln |
| delivery time | 3 weeks |
|---|
(4-chlorophenyl)-piperidin-3-ylmethanone;hydrochloride (CAS 1215723-25-3) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. IUPAC name: (4-chlorophenyl)-piperidin-3-ylmethanone;hydrochloride. InChIKey: CFHNJOOYBFHTGF-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | (4-chlorophenyl)-piperidin-3-ylmethanone;hydrochloride |
| InChIKey | CFHNJOOYBFHTGF-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C(=O)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)