CAS 1774905-24-6 appears in our catalog under these names: 4-Chloro-3h-spiro[2-benzofuran-1,4'-piperidine] hydrochloride, 95%, 4–Chloro–3H–spiro(2–benzofuran–1,4'–piperidine) hydrochloride, 4-Chloro-3H-spiro[isobenzofuran-1,4'-piperidine] hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 1g, 250mg, 100mg.
7-chlorospiro[1H-2-benzofuran-3,4'-piperidine];hydrochloride (CAS 1774905-24-6) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. IUPAC name: 7-chlorospiro[1H-2-benzofuran-3,4'-piperidine];hydrochloride. InChIKey: KWVJVASQTCNQJI-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | 7-chlorospiro[1H-2-benzofuran-3,4'-piperidine];hydrochloride |
| InChIKey | KWVJVASQTCNQJI-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(CO2)C(=CC=C3)Cl.Cl |
Computed by PubChem (NCBI)