CAS 1215723-25-3 appears in our catalog under these names: (4-CHLOROPHENYL)(PIPERIDIN-3-YL)METHANONE HCL, (4-Chlorophenyl)(piperidin-3-yl)methanone hydrochloride, 95%. Offered by: Chemat, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4-chlorophenyl)-piperidin-3-ylmethanone;hydrochloride (CAS 1215723-25-3) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. IUPAC name: (4-chlorophenyl)-piperidin-3-ylmethanone;hydrochloride. InChIKey: CFHNJOOYBFHTGF-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | (4-chlorophenyl)-piperidin-3-ylmethanone;hydrochloride |
| InChIKey | CFHNJOOYBFHTGF-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C(=O)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)