CAS 1391052-66-6 appears in our catalog under these names: 4-(3-Chlorobenzoyl)piperidine hydrochloride, 98%, 4-(3-Chlorobenzoyl)piperidine Hydrochloride, 95%, 95%, 4-(3-CHLOROBENZOYL) PIPERIDINE HCL, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg.
(3-chlorophenyl)-piperidin-4-ylmethanone;hydrochloride (CAS 1391052-66-6) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. IUPAC name: (3-chlorophenyl)-piperidin-4-ylmethanone;hydrochloride. InChIKey: NOFTZHLEMWXDOE-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | (3-chlorophenyl)-piperidin-4-ylmethanone;hydrochloride |
| InChIKey | NOFTZHLEMWXDOE-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)C2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)