CAS 414872-60-9 is the registry number for 1-(3,4-Dichloro-benzyl)-piperidin-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol (CAS 414872-60-9) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. IUPAC name: 1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol. InChIKey: DLTQYEPAQCPKMU-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | 1-[(3,4-dichlorophenyl)methyl]piperidin-4-ol |
| InChIKey | DLTQYEPAQCPKMU-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1O)CC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)