cas: 773872-13-2 — see every product listed under this CAS number, including other names
(4-Chloro-2-(trifluoromethyl)phenyl)methanol, 95%, 95% (CAS 773872-13-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G6B2-1g |
| cas | 773872-13-2 |
| size | 1g |
| availability | 19g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 592.40 Pln | |
| Chemat | 10g | 1120.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-chloro-2-(trifluoromethyl)phenyl]methanol (CAS 773872-13-2) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: [4-chloro-2-(trifluoromethyl)phenyl]methanol. InChIKey: OYVUJDHCOIJRDO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | [4-chloro-2-(trifluoromethyl)phenyl]methanol |
| InChIKey | OYVUJDHCOIJRDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)CO |
Computed by PubChem (NCBI)