CAS 1214342-76-3 appears in our catalog under these names: 1-Chloro-2-methoxy-3-(trifluoromethyl)benzene, 95%, 2-Chloro-6-(trifluoromethyl)anisole, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g.
1-chloro-2-methoxy-3-(trifluoromethyl)benzene (CAS 1214342-76-3) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: 1-chloro-2-methoxy-3-(trifluoromethyl)benzene. InChIKey: ZEGHPYMMRCPIGU-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 1-chloro-2-methoxy-3-(trifluoromethyl)benzene |
| InChIKey | ZEGHPYMMRCPIGU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=C1Cl)C(F)(F)F |
Computed by PubChem (NCBI)