CAS 80054-80-4 is the registry number for 1-Chloro-4-(2,2,2-trifluoroethoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-chloro-4-(2,2,2-trifluoroethoxy)benzene (CAS 80054-80-4) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: 1-chloro-4-(2,2,2-trifluoroethoxy)benzene. InChIKey: WMVDOKLDWNIZFP-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 1-chloro-4-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | WMVDOKLDWNIZFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC(F)(F)F)Cl |
Computed by PubChem (NCBI)