Products 116827-40-8
CAS 116827-40-8 appears in our catalog under these names: 2-(Trifluoromethoxy)benzyl chloride, 95%, 2–(Trifluoromethoxy)benzyl chloride, 1-(Chloromethyl)-2-(trifluoromethoxy)benzene, 98%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 10g.
1-(chloromethyl)-2-(trifluoromethoxy)benzene (CAS 116827-40-8) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: 1-(chloromethyl)-2-(trifluoromethoxy)benzene. InChIKey: ZGXDTWNEZOBSBJ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 1-(chloromethyl)-2-(trifluoromethoxy)benzene |
| InChIKey | ZGXDTWNEZOBSBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCl)OC(F)(F)F |
Computed by PubChem (NCBI)