CAS 400-73-7 appears in our catalog under these names: 4-Chloro-3-(trifluoromethyl)anisole, 95%, 1-Chloro-4-methoxy-2-(trifluoromethyl)benzene, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 25g.
1-chloro-4-methoxy-2-(trifluoromethyl)benzene (CAS 400-73-7) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: 1-chloro-4-methoxy-2-(trifluoromethyl)benzene. InChIKey: HUFKNQCAJLSTLH-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 1-chloro-4-methoxy-2-(trifluoromethyl)benzene |
| InChIKey | HUFKNQCAJLSTLH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)