cas: 900174-62-1 — see every product listed under this CAS number, including other names
(4-Chloro-3-ethoxyphenyl)boronic acid 97% (CAS 900174-62-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A193663-1g |
| cas | 900174-62-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 915.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A193663 |
(4-chloro-3-ethoxyphenyl)boronic acid (CAS 900174-62-1) is a chemical compound with the molecular formula C8H10BClO3 and a molecular weight of 200.43 g/mol. IUPAC name: (4-chloro-3-ethoxyphenyl)boronic acid. InChIKey: WYEAKFIRTXVYNS-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO3 |
|---|---|
| Molecular weight | 200.43 g/mol |
| IUPAC name | (4-chloro-3-ethoxyphenyl)boronic acid |
| InChIKey | WYEAKFIRTXVYNS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)OCC)(O)O |
Computed by PubChem (NCBI)