cas: 26163-40-6 — see every product listed under this CAS number, including other names
(4-Chlorophenyl)(piperidin-1-yl)methanone, ≥96%, ≥96% (CAS 26163-40-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113RXY-250mg |
| cas | 26163-40-6 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 1312.40 Pln | |
| Chemat | 5g | 4451.60 Pln |
| purity | ≥96% |
|---|---|
| delivery time | 3 weeks |
(4-chlorophenyl)-piperidin-1-ylmethanone (CAS 26163-40-6) is a chemical compound with the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. IUPAC name: (4-chlorophenyl)-piperidin-1-ylmethanone. InChIKey: GFOLEAQQESSXFL-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | (4-chlorophenyl)-piperidin-1-ylmethanone |
| InChIKey | GFOLEAQQESSXFL-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)