cas: 26163-40-6 — see every product listed under this CAS number, including other names
N-(4-Chlorobenzoyl)piperidine, 95-<97% (CAS 26163-40-6) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 200g, 300g, 400g, 500g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC5189-95-97-50g |
| cas | 26163-40-6 |
| size | 50g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 50g | 4767.62 Pln | |
| Hoffman Fine Chemicals | 100g | 7440.84 Pln | |
| Hoffman Fine Chemicals | 200g | 11721.82 Pln | |
| Hoffman Fine Chemicals | 300g | 14005.86 Pln | |
| Hoffman Fine Chemicals | 400g | 15830.54 Pln | |
| Hoffman Fine Chemicals | 500g | 16800.30 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
(4-chlorophenyl)-piperidin-1-ylmethanone (CAS 26163-40-6) is a chemical compound with the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. IUPAC name: (4-chlorophenyl)-piperidin-1-ylmethanone. InChIKey: GFOLEAQQESSXFL-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | (4-chlorophenyl)-piperidin-1-ylmethanone |
| InChIKey | GFOLEAQQESSXFL-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)