CAS 856255-58-8 appears in our catalog under these names: (4-Cyano-3-methylphenyl)boronic acid, 96%, 96%, (4-Cyano-3-methylphenyl)boronic acid, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(4-cyano-3-methylphenyl)boronic acid (CAS 856255-58-8) is a chemical compound with the molecular formula C8H8BNO2 and a molecular weight of 160.97 g/mol. IUPAC name: (4-cyano-3-methylphenyl)boronic acid. InChIKey: CCEBEGIKXKLSDR-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO2 |
|---|---|
| Molecular weight | 160.97 g/mol |
| IUPAC name | (4-cyano-3-methylphenyl)boronic acid |
| InChIKey | CCEBEGIKXKLSDR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C#N)C)(O)O |
Computed by PubChem (NCBI)