Products 147621-18-9
CAS 147621-18-9 appears in our catalog under these names: 1H-Indole-6-boronic acid, 95-<97%, 1H-Indole-6-boronic acid, ≥97-<99%, 1H–indol–6–yl–6–boronic acid, Indole-6-boronic acid, 98% , 6-Indoleboronic Acid (contains varying amounts of Anhydride). Offered by: Hoffman Fine Chemicals, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 1g, 250mg.
1H-indol-6-ylboronic acid (CAS 147621-18-9) is a chemical compound with the molecular formula C8H8BNO2 and a molecular weight of 160.97 g/mol. IUPAC name: 1H-indol-6-ylboronic acid. InChIKey: ZVMHOIWRCCZGPZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO2 |
|---|---|
| Molecular weight | 160.97 g/mol |
| IUPAC name | 1H-indol-6-ylboronic acid |
| InChIKey | ZVMHOIWRCCZGPZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=CN2)(O)O |
Computed by PubChem (NCBI)