CAS 144104-59-6 appears in our catalog under these names: Indole–5–boronic acid, 5-Indolylboronic acid/ 95+%, 5-Indolylboronic acid, 97%, (1H-Indol-5-yl)boronic acid 97%, 5-INDOLYLBORONIC ACID, >=95%. Offered by: GLPBio, Chemat, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 10g, 25g, 5g, 1g, 100MG, 500MG, 100g, 250mg.
1H-indol-5-ylboronic acid (CAS 144104-59-6) is a chemical compound with the molecular formula C8H8BNO2 and a molecular weight of 160.97 g/mol. IUPAC name: 1H-indol-5-ylboronic acid. InChIKey: VHADYSUJZAPXOW-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO2 |
|---|---|
| Molecular weight | 160.97 g/mol |
| IUPAC name | 1H-indol-5-ylboronic acid |
| InChIKey | VHADYSUJZAPXOW-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)NC=C2)(O)O |
Computed by PubChem (NCBI)