CAS 1798304-51-4 appears in our catalog under these names: (4-Cyclopropyl-6-methoxypyrimidin-5-yl)boronic acid, 98%, 98%, (4-Cyclopropyl-6-methoxypyrimidin-5-yl)boronic acid, 99.94%, (4-Cyclopropyl-6-methoxypyrimidin-5-yl)boronic acid, 97%. Offered by: Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 50g, 250g, 250mg, 1g, 5g, 10g, 25g, 100g.
(4-cyclopropyl-6-methoxypyrimidin-5-yl)boronic acid (CAS 1798304-51-4) is a chemical compound with the molecular formula C8H11BN2O3 and a molecular weight of 194.00 g/mol. IUPAC name: (4-cyclopropyl-6-methoxypyrimidin-5-yl)boronic acid. InChIKey: BYXHEUWWJYYRNH-UHFFFAOYSA-N.
| Molecular formula | C8H11BN2O3 |
|---|---|
| Molecular weight | 194.00 g/mol |
| IUPAC name | (4-cyclopropyl-6-methoxypyrimidin-5-yl)boronic acid |
| InChIKey | BYXHEUWWJYYRNH-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=CN=C1OC)C2CC2)(O)O |
Computed by PubChem (NCBI)