Products 1182315-47-4
CAS 1182315-47-4 appears in our catalog under these names: (4-(3-Methylureido)phenyl)boronic acid, 95%, (4-(3-Methylureido)phenyl)boronic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg.
[4-(methylcarbamoylamino)phenyl]boronic acid (CAS 1182315-47-4) is a chemical compound with the molecular formula C8H11BN2O3 and a molecular weight of 194.00 g/mol. IUPAC name: [4-(methylcarbamoylamino)phenyl]boronic acid. InChIKey: ABBXFJVXOUAGFW-UHFFFAOYSA-N.
| Molecular formula | C8H11BN2O3 |
|---|---|
| Molecular weight | 194.00 g/mol |
| IUPAC name | [4-(methylcarbamoylamino)phenyl]boronic acid |
| InChIKey | ABBXFJVXOUAGFW-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NC(=O)NC)(O)O |
Computed by PubChem (NCBI)