CAS 136237-84-8 appears in our catalog under these names: 2-Acetamido-5-aminophenylboronic acid, 96%, 2-Acetamido-5-aminophenylboronic Acid. Offered by: Combi-blocks, TRC. Available pack sizes: 50mg, 1g.
(2-acetamido-5-aminophenyl)boronic acid (CAS 136237-84-8) is a chemical compound with the molecular formula C8H11BN2O3 and a molecular weight of 194.00 g/mol. IUPAC name: (2-acetamido-5-aminophenyl)boronic acid. InChIKey: GZPCXQOFTGPVJZ-UHFFFAOYSA-N.
| Molecular formula | C8H11BN2O3 |
|---|---|
| Molecular weight | 194.00 g/mol |
| IUPAC name | (2-acetamido-5-aminophenyl)boronic acid |
| InChIKey | GZPCXQOFTGPVJZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)N)NC(=O)C)(O)O |
Computed by PubChem (NCBI)