CAS 1111637-72-9 appears in our catalog under these names: 2-Acetamido-4-methylpyridine-5-boronic acid, 95%, 6-(Acetylamino)-4-methylpyridine-3-boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
(6-acetamido-4-methyl-3-pyridinyl)boronic acid (CAS 1111637-72-9) is a chemical compound with the molecular formula C8H11BN2O3 and a molecular weight of 194.00 g/mol. IUPAC name: (6-acetamido-4-methyl-3-pyridinyl)boronic acid. InChIKey: PKUXQHBKIUCFPL-UHFFFAOYSA-N.
| Molecular formula | C8H11BN2O3 |
|---|---|
| Molecular weight | 194.00 g/mol |
| IUPAC name | (6-acetamido-4-methyl-3-pyridinyl)boronic acid |
| InChIKey | PKUXQHBKIUCFPL-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1C)NC(=O)C)(O)O |
Computed by PubChem (NCBI)