CAS 2225152-46-3 appears in our catalog under these names: (2-(Tetrahydrofuran-2-yl)pyrimidin-5-yl)boronic acid, 98%, (2–(tetrahydrofuran–2–yl)pyrimidin–5–yl)boronic acid. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 100mg, 25mg, 5mg.
[2-(oxolan-2-yl)pyrimidin-5-yl]boronic acid (CAS 2225152-46-3) is a chemical compound with the molecular formula C8H11BN2O3 and a molecular weight of 194.00 g/mol. IUPAC name: [2-(oxolan-2-yl)pyrimidin-5-yl]boronic acid. InChIKey: XTKCKJBTJDKWTN-UHFFFAOYSA-N.
| Molecular formula | C8H11BN2O3 |
|---|---|
| Molecular weight | 194.00 g/mol |
| IUPAC name | [2-(oxolan-2-yl)pyrimidin-5-yl]boronic acid |
| InChIKey | XTKCKJBTJDKWTN-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)C2CCCO2)(O)O |
Computed by PubChem (NCBI)