cas: 871125-72-3 — see every product listed under this CAS number, including other names
(4-Ethoxy-2,3,5,6-tetrafluorophenyl)boronic acid 98% (CAS 871125-72-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A691830-100mg |
| cas | 871125-72-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 259.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A691830 |
(4-ethoxy-2,3,5,6-tetrafluorophenyl)boronic acid (CAS 871125-72-3) is a chemical compound with the molecular formula C8H7BF4O3 and a molecular weight of 237.95 g/mol. IUPAC name: (4-ethoxy-2,3,5,6-tetrafluorophenyl)boronic acid. InChIKey: IPNVLSNRALXTDR-UHFFFAOYSA-N.
| Molecular formula | C8H7BF4O3 |
|---|---|
| Molecular weight | 237.95 g/mol |
| IUPAC name | (4-ethoxy-2,3,5,6-tetrafluorophenyl)boronic acid |
| InChIKey | IPNVLSNRALXTDR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C(=C1F)F)OCC)F)F)(O)O |
Computed by PubChem (NCBI)