cas: 871125-72-3 — see every product listed under this CAS number, including other names
(4-Ethoxy-2,3,5,6-tetrafluorophenyl)boronic acid, 98% (CAS 871125-72-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224720-100MG |
| cas | 871125-72-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 414.46 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(4-ethoxy-2,3,5,6-tetrafluorophenyl)boronic acid (CAS 871125-72-3) is a chemical compound with the molecular formula C8H7BF4O3 and a molecular weight of 237.95 g/mol. IUPAC name: (4-ethoxy-2,3,5,6-tetrafluorophenyl)boronic acid. InChIKey: IPNVLSNRALXTDR-UHFFFAOYSA-N.
| Molecular formula | C8H7BF4O3 |
|---|---|
| Molecular weight | 237.95 g/mol |
| IUPAC name | (4-ethoxy-2,3,5,6-tetrafluorophenyl)boronic acid |
| InChIKey | IPNVLSNRALXTDR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C(=C1F)F)OCC)F)F)(O)O |
Computed by PubChem (NCBI)