CAS 871125-72-3 appears in our catalog under these names: 4-Ethoxy-2,3,5,6-tetrafluorophenylboronic acid, 98%, (4-Ethoxy-2,3,5,6-tetrafluorophenyl)boronic acid 98%, 4-Ethoxy-2,3,5,6-tetrafluorophenylboronic acid, 98%, 98%, (4-Ethoxy-2,3,5,6-tetrafluorophenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
(4-ethoxy-2,3,5,6-tetrafluorophenyl)boronic acid (CAS 871125-72-3) is a chemical compound with the molecular formula C8H7BF4O3 and a molecular weight of 237.95 g/mol. IUPAC name: (4-ethoxy-2,3,5,6-tetrafluorophenyl)boronic acid. InChIKey: IPNVLSNRALXTDR-UHFFFAOYSA-N.
| Molecular formula | C8H7BF4O3 |
|---|---|
| Molecular weight | 237.95 g/mol |
| IUPAC name | (4-ethoxy-2,3,5,6-tetrafluorophenyl)boronic acid |
| InChIKey | IPNVLSNRALXTDR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C(=C1F)F)OCC)F)F)(O)O |
Computed by PubChem (NCBI)