Products 1701449-45-7

CAS 1701449-45-7 is the registry number for 4-Fluoro-3-methoxy-5-(trifluoromethyl)phenylboronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

[4-fluoro-3-methoxy-5-(trifluoromethyl)phenyl]boronic acid (CAS 1701449-45-7) is a chemical compound with the molecular formula C8H7BF4O3 and a molecular weight of 237.95 g/mol. IUPAC name: [4-fluoro-3-methoxy-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: PTPKNQLKGQLZKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BF4O3
Molecular weight237.95 g/mol
IUPAC name[4-fluoro-3-methoxy-5-(trifluoromethyl)phenyl]boronic acid
InChIKeyPTPKNQLKGQLZKZ-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)OC)F)C(F)(F)F)(O)O

Computed by PubChem (NCBI)