CAS 850589-55-8 appears in our catalog under these names: 3-Fluoro-5-(2,2,2-trifluoroethoxy)phenylboronic acid, 98%, (3-Fluoro-5-(2,2,2-trifluoroethoxy)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid (CAS 850589-55-8) is a chemical compound with the molecular formula C8H7BF4O3 and a molecular weight of 237.95 g/mol. IUPAC name: [3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid. InChIKey: PNKCVIOQOZYOLD-UHFFFAOYSA-N.
| Molecular formula | C8H7BF4O3 |
|---|---|
| Molecular weight | 237.95 g/mol |
| IUPAC name | [3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid |
| InChIKey | PNKCVIOQOZYOLD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)OCC(F)(F)F)(O)O |
Computed by PubChem (NCBI)