cas: 874219-19-9 — see every product listed under this CAS number, including other names
(4-Fluoro-3-(methylcarbamoyl)phenyl)boronic acid, 97%, 97% (CAS 874219-19-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147CQ-250mg |
| cas | 874219-19-9 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 352.40 Pln | |
| Chemat | 10g | 530.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[4-fluoro-3-(methylcarbamoyl)phenyl]boronic acid (CAS 874219-19-9) is a chemical compound with the molecular formula C8H9BFNO3 and a molecular weight of 196.97 g/mol. IUPAC name: [4-fluoro-3-(methylcarbamoyl)phenyl]boronic acid. InChIKey: DVDSMLPVTUSIFM-UHFFFAOYSA-N.
| Molecular formula | C8H9BFNO3 |
|---|---|
| Molecular weight | 196.97 g/mol |
| IUPAC name | [4-fluoro-3-(methylcarbamoyl)phenyl]boronic acid |
| InChIKey | DVDSMLPVTUSIFM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)NC)(O)O |
Computed by PubChem (NCBI)