(4-Fluoro-5-formyl-2-methylphenyl)boronic acid, 97%
cas: 2377606-69-2 — see every product listed under this CAS number, including other names
(4-Fluoro-5-formyl-2-methylphenyl)boronic acid, 97% (CAS 2377606-69-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A445881-250mg |
| cas | 2377606-69-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 2541.20 Pln | |
| BLDpharm | 100mg | 136.64 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 297.70 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4-fluoro-5-formyl-2-methylphenyl)boronic acid (CAS 2377606-69-2) is a chemical compound with the molecular formula C8H8BFO3 and a molecular weight of 181.96 g/mol. IUPAC name: (4-fluoro-5-formyl-2-methylphenyl)boronic acid. InChIKey: BGWYJGKMSSYAEL-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO3 |
|---|---|
| Molecular weight | 181.96 g/mol |
| IUPAC name | (4-fluoro-5-formyl-2-methylphenyl)boronic acid |
| InChIKey | BGWYJGKMSSYAEL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)F)C=O)(O)O |
Computed by PubChem (NCBI)