cas: 943918-05-6 — see every product listed under this CAS number, including other names
(4-Hydroxy-2-(trifluoromethyl)phenyl)boronic acid 98% (CAS 943918-05-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A690294-100mg |
| cas | 943918-05-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1210.31 Pln | |
| Ambeed | 250mg | 1705.38 Pln | |
| Ambeed | 1g | 4152.88 Pln | |
| Ambeed | 5g | 13714.81 Pln | |
| Ambeed | 10g | 22815.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A690294 |
[4-hydroxy-2-(trifluoromethyl)phenyl]boronic acid (CAS 943918-05-6) is a chemical compound with the molecular formula C7H6BF3O3 and a molecular weight of 205.93 g/mol. IUPAC name: [4-hydroxy-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: MHKOVSRFDDLIFU-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O3 |
|---|---|
| Molecular weight | 205.93 g/mol |
| IUPAC name | [4-hydroxy-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | MHKOVSRFDDLIFU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)O)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)